C22H21F5O7S — CID 87269886
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 87269886) has the molecular formula C22H21F5O7S and a molecular weight of 524.46 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 87269886 |
| Molecular Formula | C22H21F5O7S |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)Cc2ccc(OC)c(OC(=O)C(F)(F)C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C22H21F5O7S/c1-30-14-10-17(32-3)15(18(11-14)33-4)7-8-35(29)12-13-5-6-16(31-2)19(9-13)34-20(28)21(23,24)22(25,26)27/h5-11H,12H2,1-4H3/b8-7+ |
| InChIKey | LXCFCXCQLXCIKL-BQYQJAHWSA-N |
| XLogP | 4.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|