C23H25ClO8S — CID 11340946
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 4-chloro-4-oxobutanoate (PubChem CID 11340946) has the molecular formula C23H25ClO8S and a molecular weight of 496.97 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 4-chloro-4-oxobutanoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 4-chloro-4-oxobutanoate |
|---|---|
| PubChem CID | 11340946 |
| Molecular Formula | C23H25ClO8S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] 4-chloro-4-oxobutanoate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)Cc2ccc(OC)c(OC(=O)CCC(=O)Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C23H25ClO8S/c1-28-16-12-19(30-3)17(20(13-16)31-4)9-10-33(27)14-15-5-6-18(29-2)21(11-15)32-23(26)8-7-22(24)25/h5-6,9-13H,7-8,14H2,1-4H3/b10-9+ |
| InChIKey | BZMNXKUYBUKKRG-MDZDMXLPSA-N |
| XLogP | 4.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|