C25H33NO8S — CID 69119902
[2-methoxy-5-[[(E)-2-(2,4,6-triethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] (2S)-2-amino-3-hydroxypropanoate (PubChem CID 69119902) has the molecular formula C25H33NO8S and a molecular weight of 507.61 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-triethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] (2S)-2-amino-3-hydroxypropanoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-triethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] (2S)-2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 69119902 |
| Molecular Formula | C25H33NO8S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-triethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] (2S)-2-amino-3-hydroxypropanoate |
| SMILES | CCOc1cc(OCC)c(/C=C/S(=O)Cc2ccc(OC)c(OC(=O)[C@@H](N)CO)c2)c(OCC)c1 |
| InChI | InChI=1S/C25H33NO8S/c1-5-31-18-13-22(32-6-2)19(23(14-18)33-7-3)10-11-35(29)16-17-8-9-21(30-4)24(12-17)34-25(28)20(26)15-27/h8-14,20,27H,5-7,15-16,26H2,1-4H3/b11-10+/t20-,35?/m0/s1 |
| InChIKey | ZRBKYMWZEQQSNV-UFYLQUKZSA-N |
| XLogP | 3.04 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|