C22H27NO8S — CID 67103049
[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] 2-amino-3-hydroxypropanoate (PubChem CID 67103049) has the molecular formula C22H27NO8S and a molecular weight of 465.52 g/mol. Its IUPAC name is [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] 2-amino-3-hydroxypropanoate.
| Compound Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] 2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 67103049 |
| Molecular Formula | C22H27NO8S |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] 2-amino-3-hydroxypropanoate |
| SMILES | COc1cc(OC)c(C=CS(=O)Cc2ccc(OC)c(OC(=O)C(N)CO)c2)c(OC)c1 |
| InChI | InChI=1S/C22H27NO8S/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-32(26)13-14-5-6-18(28-2)21(9-14)31-22(25)17(23)12-24/h5-11,17,24H,12-13,23H2,1-4H3 |
| InChIKey | WMHXCXLOOFCYGA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|