C23H31O9PS — CID 67103179
diethyl [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] phosphate (PubChem CID 67103179) has the molecular formula C23H31O9PS and a molecular weight of 514.53 g/mol. Its IUPAC name is diethyl [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] phosphate.
| Compound Name | diethyl [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] phosphate |
|---|---|
| PubChem CID | 67103179 |
| Molecular Formula | C23H31O9PS |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | diethyl [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]phenyl] phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cc(CS(=O)C=Cc2c(OC)cc(OC)cc2OC)ccc1OC |
| InChI | InChI=1S/C23H31O9PS/c1-7-30-33(24,31-8-2)32-23-13-17(9-10-20(23)27-4)16-34(25)12-11-19-21(28-5)14-18(26-3)15-22(19)29-6/h9-15H,7-8,16H2,1-6H3 |
| InChIKey | JAQBIRIGJOYDBY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|