C23H32NO10PS — CID 69131035
diethyl [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfamoylmethyl]phenyl] phosphate (PubChem CID 69131035) has the molecular formula C23H32NO10PS and a molecular weight of 545.55 g/mol. Its IUPAC name is diethyl [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfamoylmethyl]phenyl] phosphate.
| Compound Name | diethyl [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfamoylmethyl]phenyl] phosphate |
|---|---|
| PubChem CID | 69131035 |
| Molecular Formula | C23H32NO10PS |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | diethyl [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfamoylmethyl]phenyl] phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cc(CS(=O)(=O)N/C=C/c2c(OC)cc(OC)cc2OC)ccc1OC |
| InChI | InChI=1S/C23H32NO10PS/c1-7-32-35(25,33-8-2)34-23-13-17(9-10-20(23)29-4)16-36(26,27)24-12-11-19-21(30-5)14-18(28-3)15-22(19)31-6/h9-15,24H,7-8,16H2,1-6H3/b12-11+ |
| InChIKey | BBCQMMWBOOJXCD-VAWYXSNFSA-N |
| XLogP | 4.37 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|