C8H8F2O2S — CID 69424643
2-(3,4-difluorophenyl)ethanesulfinic acid (PubChem CID 69424643) has the molecular formula C8H8F2O2S and a molecular weight of 206.21 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)ethanesulfinic acid.
| Compound Name | 2-(3,4-difluorophenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 69424643 |
| Molecular Formula | C8H8F2O2S |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 2-(3,4-difluorophenyl)ethanesulfinic acid |
| SMILES | O=S(O)CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H8F2O2S/c9-7-2-1-6(5-8(7)10)3-4-13(11)12/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | KQYDPJPAUQRPNQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|