C10H8F6O2S — CID 22506669
2-[3,5-bis(trifluoromethyl)phenyl]ethanesulfinic acid (PubChem CID 22506669) has the molecular formula C10H8F6O2S and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]ethanesulfinic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 22506669 |
| Molecular Formula | C10H8F6O2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethanesulfinic acid |
| SMILES | O=S(O)CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6O2S/c11-9(12,13)7-3-6(1-2-19(17)18)4-8(5-7)10(14,15)16/h3-5H,1-2H2,(H,17,18) |
| InChIKey | OZYUUPLOWWBZHT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|