C12H16ClFO3S — CID 115477393
2-chloro-4-(2,2-diethoxyethylsulfinyl)-1-fluorobenzene (PubChem CID 115477393) has the molecular formula C12H16ClFO3S and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-chloro-4-(2,2-diethoxyethylsulfinyl)-1-fluorobenzene.
| Compound Name | 2-chloro-4-(2,2-diethoxyethylsulfinyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 115477393 |
| Molecular Formula | C12H16ClFO3S |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-chloro-4-(2,2-diethoxyethylsulfinyl)-1-fluorobenzene |
| SMILES | CCOC(CS(=O)c1ccc(F)c(Cl)c1)OCC |
| InChI | InChI=1S/C12H16ClFO3S/c1-3-16-12(17-4-2)8-18(15)9-5-6-11(14)10(13)7-9/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | IYDQUOJHNAPELW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|