C13H19F2NOS — CID 64652845
1-(3,4-difluorophenyl)sulfinyl-N,3,3-trimethylbutan-2-amine (PubChem CID 64652845) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfinyl-N,3,3-trimethylbutan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)sulfinyl-N,3,3-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 64652845 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfinyl-N,3,3-trimethylbutan-2-amine |
| SMILES | CNC(CS(=O)c1ccc(F)c(F)c1)C(C)(C)C |
| InChI | InChI=1S/C13H19F2NOS/c1-13(2,3)12(16-4)8-18(17)9-5-6-10(14)11(15)7-9/h5-7,12,16H,8H2,1-4H3 |
| InChIKey | INYKJQDZNGVHMS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |