C14H22ClNOS — CID 64658378
1-(3-chlorophenyl)sulfinyl-N-ethyl-3,3-dimethylbutan-2-amine (PubChem CID 64658378) has the molecular formula C14H22ClNOS and a molecular weight of 287.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfinyl-N-ethyl-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfinyl-N-ethyl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 64658378 |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(3-chlorophenyl)sulfinyl-N-ethyl-3,3-dimethylbutan-2-amine |
| SMILES | CCNC(CS(=O)c1cccc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C14H22ClNOS/c1-5-16-13(14(2,3)4)10-18(17)12-8-6-7-11(15)9-12/h6-9,13,16H,5,10H2,1-4H3 |
| InChIKey | HFJOOEHXOUDUOB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |