C14H20ClNO2S — CID 104754280
2-(3-chlorophenyl)sulfinyl-N-ethyl-1-(oxolan-3-yl)ethanamine (PubChem CID 104754280) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfinyl-N-ethyl-1-(oxolan-3-yl)ethanamine.
| Compound Name | 2-(3-chlorophenyl)sulfinyl-N-ethyl-1-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104754280 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(3-chlorophenyl)sulfinyl-N-ethyl-1-(oxolan-3-yl)ethanamine |
| SMILES | CCNC(CS(=O)c1cccc(Cl)c1)C1CCOC1 |
| InChI | InChI=1S/C14H20ClNO2S/c1-2-16-14(11-6-7-18-9-11)10-19(17)13-5-3-4-12(15)8-13/h3-5,8,11,14,16H,2,6-7,9-10H2,1H3 |
| InChIKey | APIDHVDVYDSZET-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |