C16H24ClNOS — CID 104754287
N-[2-(3-chlorophenyl)sulfinyl-1-cyclopentylethyl]propan-1-amine (PubChem CID 104754287) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)sulfinyl-1-cyclopentylethyl]propan-1-amine.
| Compound Name | N-[2-(3-chlorophenyl)sulfinyl-1-cyclopentylethyl]propan-1-amine |
|---|---|
| PubChem CID | 104754287 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[2-(3-chlorophenyl)sulfinyl-1-cyclopentylethyl]propan-1-amine |
| SMILES | CCCNC(CS(=O)c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C16H24ClNOS/c1-2-10-18-16(13-6-3-4-7-13)12-20(19)15-9-5-8-14(17)11-15/h5,8-9,11,13,16,18H,2-4,6-7,10,12H2,1H3 |
| InChIKey | OQGABUKRDRJLHI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |