C14H19Cl2NO3S — CID 104754077
2-(2,6-dichlorophenyl)sulfonyl-N-ethyl-1-(oxolan-3-yl)ethanamine (PubChem CID 104754077) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)sulfonyl-N-ethyl-1-(oxolan-3-yl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)sulfonyl-N-ethyl-1-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104754077 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)sulfonyl-N-ethyl-1-(oxolan-3-yl)ethanamine |
| SMILES | CCNC(CS(=O)(=O)c1c(Cl)cccc1Cl)C1CCOC1 |
| InChI | InChI=1S/C14H19Cl2NO3S/c1-2-17-13(10-6-7-20-8-10)9-21(18,19)14-11(15)4-3-5-12(14)16/h3-5,10,13,17H,2,6-9H2,1H3 |
| InChIKey | SCDKXQUEUCPJOZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |