C12H15Cl2NO2S — CID 64675532
1-cyclopropyl-2-(2,6-dichlorophenyl)sulfonyl-N-methylethanamine (PubChem CID 64675532) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,6-dichlorophenyl)sulfonyl-N-methylethanamine.
| Compound Name | 1-cyclopropyl-2-(2,6-dichlorophenyl)sulfonyl-N-methylethanamine |
|---|---|
| PubChem CID | 64675532 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 1-cyclopropyl-2-(2,6-dichlorophenyl)sulfonyl-N-methylethanamine |
| SMILES | CNC(CS(=O)(=O)c1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C12H15Cl2NO2S/c1-15-11(8-5-6-8)7-18(16,17)12-9(13)3-2-4-10(12)14/h2-4,8,11,15H,5-7H2,1H3 |
| InChIKey | KSAQWWLLLCQZME-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |