About 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine
1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine (PubChem CID 104754082) has the molecular formula C14H19Cl2NO2S
and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine |
| PubChem CID | 104754082 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine |
| SMILES | NC(CS(=O)(=O)c1c(Cl)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2NO2S/c15-11-7-4-8-12(16)14(11)20(18,19)9-13(17)10-5-2-1-3-6-10/h4,7-8,10,13H,1-3,5-6,9,17H2 |
| InChIKey | FYTBILKBAITVTO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine?
The IUPAC name of 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine (CID 104754082) is 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine.
What is the SMILES notation for 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine?
The canonical SMILES for 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine is NC(CS(=O)(=O)c1c(Cl)cccc1Cl)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine?
The InChIKey is FYTBILKBAITVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2NO2S/c15-11-7-4-8-12(16)14(11)20(18,19)9-13(17)10-5-2-1-3-6-10/h4,7-8,10,13H,1-3,5-6,9,17H2.
What are the key properties of 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine?
1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine has a molecular weight of 336.28 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(2,6-dichlorophenyl)sulfonylethanamine is sourced from PubChem (CID 104754082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).