C16H25NO2S — CID 104753847
1-cyclopentyl-2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine (PubChem CID 104753847) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 1-cyclopentyl-2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine.
| Compound Name | 1-cyclopentyl-2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine |
|---|---|
| PubChem CID | 104753847 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-cyclopentyl-2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine |
| SMILES | CNC(CS(=O)(=O)c1ccc(C)c(C)c1)C1CCCC1 |
| InChI | InChI=1S/C16H25NO2S/c1-12-8-9-15(10-13(12)2)20(18,19)11-16(17-3)14-6-4-5-7-14/h8-10,14,16-17H,4-7,11H2,1-3H3 |
| InChIKey | QZTVGIBMAPUABI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |