C17H27NO2S — CID 104754194
1-cyclohexyl-N-methyl-2-[(3-methylphenyl)methylsulfonyl]ethanamine (PubChem CID 104754194) has the molecular formula C17H27NO2S and a molecular weight of 309.47 g/mol. Its IUPAC name is 1-cyclohexyl-N-methyl-2-[(3-methylphenyl)methylsulfonyl]ethanamine.
| Compound Name | 1-cyclohexyl-N-methyl-2-[(3-methylphenyl)methylsulfonyl]ethanamine |
|---|---|
| PubChem CID | 104754194 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-cyclohexyl-N-methyl-2-[(3-methylphenyl)methylsulfonyl]ethanamine |
| SMILES | CNC(CS(=O)(=O)Cc1cccc(C)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H27NO2S/c1-14-7-6-8-15(11-14)12-21(19,20)13-17(18-2)16-9-4-3-5-10-16/h6-8,11,16-18H,3-5,9-10,12-13H2,1-2H3 |
| InChIKey | SFMRVYFJAUSCBD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |