C15H23NO2S — CID 104754126
1-cyclopentyl-N-methyl-2-(2-methylphenyl)sulfonylethanamine (PubChem CID 104754126) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-cyclopentyl-N-methyl-2-(2-methylphenyl)sulfonylethanamine.
| Compound Name | 1-cyclopentyl-N-methyl-2-(2-methylphenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 104754126 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-cyclopentyl-N-methyl-2-(2-methylphenyl)sulfonylethanamine |
| SMILES | CNC(CS(=O)(=O)c1ccccc1C)C1CCCC1 |
| InChI | InChI=1S/C15H23NO2S/c1-12-7-3-6-10-15(12)19(17,18)11-14(16-2)13-8-4-5-9-13/h3,6-7,10,13-14,16H,4-5,8-9,11H2,1-2H3 |
| InChIKey | FSIDXDJXLHGEDO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |