C16H26N2O2S — CID 106738112
1-cyclopentyl-N-(2-propylsulfonylphenyl)ethane-1,2-diamine (PubChem CID 106738112) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-cyclopentyl-N-(2-propylsulfonylphenyl)ethane-1,2-diamine.
| Compound Name | 1-cyclopentyl-N-(2-propylsulfonylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106738112 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-cyclopentyl-N-(2-propylsulfonylphenyl)ethane-1,2-diamine |
| SMILES | CCCS(=O)(=O)c1ccccc1NC(CN)C1CCCC1 |
| InChI | InChI=1S/C16H26N2O2S/c1-2-11-21(19,20)16-10-6-5-9-14(16)18-15(12-17)13-7-3-4-8-13/h5-6,9-10,13,15,18H,2-4,7-8,11-12,17H2,1H3 |
| InChIKey | LVBKYOAQBCHQCA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |