C13H19BrN2 — CID 65385964
N-(2-bromophenyl)-1-cyclopentylethane-1,2-diamine (PubChem CID 65385964) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-cyclopentylethane-1,2-diamine.
| Compound Name | N-(2-bromophenyl)-1-cyclopentylethane-1,2-diamine |
|---|---|
| PubChem CID | 65385964 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(2-bromophenyl)-1-cyclopentylethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Br)C1CCCC1 |
| InChI | InChI=1S/C13H19BrN2/c14-11-7-3-4-8-12(11)16-13(9-15)10-5-1-2-6-10/h3-4,7-8,10,13,16H,1-2,5-6,9,15H2 |
| InChIKey | GUZGGWTYYPAALA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |