C12H17BrN2O — CID 82835319
N-(2-bromophenyl)-1-(oxolan-2-yl)ethane-1,2-diamine (PubChem CID 82835319) has the molecular formula C12H17BrN2O and a molecular weight of 285.18 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-(oxolan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2-bromophenyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82835319 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(2-bromophenyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Br)C1CCCO1 |
| InChI | InChI=1S/C12H17BrN2O/c13-9-4-1-2-5-10(9)15-11(8-14)12-6-3-7-16-12/h1-2,4-5,11-12,15H,3,6-8,14H2 |
| InChIKey | YXMRPJPPQAUVOE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |