C15H18BrN3O — CID 116783724
N-(3-bromoquinolin-8-yl)-1-(oxolan-2-yl)ethane-1,2-diamine (PubChem CID 116783724) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is N-(3-bromoquinolin-8-yl)-1-(oxolan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(3-bromoquinolin-8-yl)-1-(oxolan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116783724 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(3-bromoquinolin-8-yl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| SMILES | NCC(Nc1cccc2cc(Br)cnc12)C1CCCO1 |
| InChI | InChI=1S/C15H18BrN3O/c16-11-7-10-3-1-4-12(15(10)18-9-11)19-13(8-17)14-5-2-6-20-14/h1,3-4,7,9,13-14,19H,2,5-6,8,17H2 |
| InChIKey | MMODBAMCOMDGME-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |