C15H20N4 — CID 106738352
N-cinnolin-4-yl-1-cyclopentylethane-1,2-diamine (PubChem CID 106738352) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-cinnolin-4-yl-1-cyclopentylethane-1,2-diamine.
| Compound Name | N-cinnolin-4-yl-1-cyclopentylethane-1,2-diamine |
|---|---|
| PubChem CID | 106738352 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-cinnolin-4-yl-1-cyclopentylethane-1,2-diamine |
| SMILES | NCC(Nc1cnnc2ccccc12)C1CCCC1 |
| InChI | InChI=1S/C15H20N4/c16-9-14(11-5-1-2-6-11)18-15-10-17-19-13-8-4-3-7-12(13)15/h3-4,7-8,10-11,14H,1-2,5-6,9,16H2,(H,18,19) |
| InChIKey | DKYYKCQTVFAAJV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |