C11H13ClO3S — CID 79620487
3-(3-chlorophenyl)sulfinyl-2,2-dimethylpropanoic acid (PubChem CID 79620487) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfinyl-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-chlorophenyl)sulfinyl-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79620487 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-(3-chlorophenyl)sulfinyl-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CS(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H13ClO3S/c1-11(2,10(13)14)7-16(15)9-5-3-4-8(12)6-9/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | DKPFHJFYHHHBCE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |