C15H23Cl2NOS — CID 115477659
1-(2,6-dichlorophenyl)sulfinyl-3,3-dimethyl-N-propylbutan-2-amine (PubChem CID 115477659) has the molecular formula C15H23Cl2NOS and a molecular weight of 336.33 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfinyl-3,3-dimethyl-N-propylbutan-2-amine.
| Compound Name | 1-(2,6-dichlorophenyl)sulfinyl-3,3-dimethyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 115477659 |
| Molecular Formula | C15H23Cl2NOS |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfinyl-3,3-dimethyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CS(=O)c1c(Cl)cccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H23Cl2NOS/c1-5-9-18-13(15(2,3)4)10-20(19)14-11(16)7-6-8-12(14)17/h6-8,13,18H,5,9-10H2,1-4H3 |
| InChIKey | VQAJAOQMIAYOFW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |