C13H29NOS — CID 64651287
1-butan-2-ylsulfinyl-3,3-dimethyl-N-propylbutan-2-amine (PubChem CID 64651287) has the molecular formula C13H29NOS and a molecular weight of 247.45 g/mol. Its IUPAC name is 1-butan-2-ylsulfinyl-3,3-dimethyl-N-propylbutan-2-amine.
| Compound Name | 1-butan-2-ylsulfinyl-3,3-dimethyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 64651287 |
| Molecular Formula | C13H29NOS |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 1-butan-2-ylsulfinyl-3,3-dimethyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CS(=O)C(C)CC)C(C)(C)C |
| InChI | InChI=1S/C13H29NOS/c1-7-9-14-12(13(4,5)6)10-16(15)11(3)8-2/h11-12,14H,7-10H2,1-6H3 |
| InChIKey | SLXXEFAEGHRNPV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |