C14H31NOS — CID 107758876
3,3-dimethyl-1-pentylsulfinyl-N-propylbutan-2-amine (PubChem CID 107758876) has the molecular formula C14H31NOS and a molecular weight of 261.47 g/mol. Its IUPAC name is 3,3-dimethyl-1-pentylsulfinyl-N-propylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-pentylsulfinyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 107758876 |
| Molecular Formula | C14H31NOS |
| Molecular Weight | 261.47 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 3,3-dimethyl-1-pentylsulfinyl-N-propylbutan-2-amine |
| SMILES | CCCCCS(=O)CC(NCCC)C(C)(C)C |
| InChI | InChI=1S/C14H31NOS/c1-6-8-9-11-17(16)12-13(14(3,4)5)15-10-7-2/h13,15H,6-12H2,1-5H3 |
| InChIKey | DNPHAWUQMDEQFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|