C18H31NOS — CID 107758918
N-[1-(3,5-dimethylphenyl)-2-pentylsulfinylethyl]propan-1-amine (PubChem CID 107758918) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is N-[1-(3,5-dimethylphenyl)-2-pentylsulfinylethyl]propan-1-amine.
| Compound Name | N-[1-(3,5-dimethylphenyl)-2-pentylsulfinylethyl]propan-1-amine |
|---|---|
| PubChem CID | 107758918 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[1-(3,5-dimethylphenyl)-2-pentylsulfinylethyl]propan-1-amine |
| SMILES | CCCCCS(=O)CC(NCCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H31NOS/c1-5-7-8-10-21(20)14-18(19-9-6-2)17-12-15(3)11-16(4)13-17/h11-13,18-19H,5-10,14H2,1-4H3 |
| InChIKey | NHIGXZDCJWFCIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|