C14H19F3O — CID 174855651
1,2,4-trifluoro-5-(3-methyl-3-propan-2-yloxybutyl)benzene (PubChem CID 174855651) has the molecular formula C14H19F3O and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,2,4-trifluoro-5-(3-methyl-3-propan-2-yloxybutyl)benzene.
| Compound Name | 1,2,4-trifluoro-5-(3-methyl-3-propan-2-yloxybutyl)benzene |
|---|---|
| PubChem CID | 174855651 |
| Molecular Formula | C14H19F3O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1,2,4-trifluoro-5-(3-methyl-3-propan-2-yloxybutyl)benzene |
| SMILES | CC(C)OC(C)(C)CCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H19F3O/c1-9(2)18-14(3,4)6-5-10-7-12(16)13(17)8-11(10)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | JORKAVRYQJZDRM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|