C10H13F2NO — CID 117289972
2-(4-aminobutyl)-4,5-difluorophenol (PubChem CID 117289972) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(4-aminobutyl)-4,5-difluorophenol.
| Compound Name | 2-(4-aminobutyl)-4,5-difluorophenol |
|---|---|
| PubChem CID | 117289972 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(4-aminobutyl)-4,5-difluorophenol |
| SMILES | NCCCCc1cc(F)c(F)cc1O |
| InChI | InChI=1S/C10H13F2NO/c11-8-5-7(3-1-2-4-13)10(14)6-9(8)12/h5-6,14H,1-4,13H2 |
| InChIKey | GXNGIRIRIVBIGC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|