C10H12N2O2 — CID 117282929
5-(3-aminopropyl)-2,4-dihydroxybenzonitrile (PubChem CID 117282929) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-(3-aminopropyl)-2,4-dihydroxybenzonitrile.
| Compound Name | 5-(3-aminopropyl)-2,4-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 117282929 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-(3-aminopropyl)-2,4-dihydroxybenzonitrile |
| SMILES | N#Cc1cc(CCCN)c(O)cc1O |
| InChI | InChI=1S/C10H12N2O2/c11-3-1-2-7-4-8(6-12)10(14)5-9(7)13/h4-5,13-14H,1-3,11H2 |
| InChIKey | VFXOTECDUNGDQZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |