C12H17NO3 — CID 117319795
8-(3-aminopropyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol (PubChem CID 117319795) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 8-(3-aminopropyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol.
| Compound Name | 8-(3-aminopropyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol |
|---|---|
| PubChem CID | 117319795 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 8-(3-aminopropyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol |
| SMILES | NCCCc1cc2c(cc1O)OCCCO2 |
| InChI | InChI=1S/C12H17NO3/c13-4-1-3-9-7-11-12(8-10(9)14)16-6-2-5-15-11/h7-8,14H,1-6,13H2 |
| InChIKey | CTGQUGAMVUHHPC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |