C9H11ClFNO2 — CID 84787142
4-(3-aminopropyl)-2-chloro-6-fluorobenzene-1,3-diol (PubChem CID 84787142) has the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. Its IUPAC name is 4-(3-aminopropyl)-2-chloro-6-fluorobenzene-1,3-diol.
| Compound Name | 4-(3-aminopropyl)-2-chloro-6-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84787142 |
| Molecular Formula | C9H11ClFNO2 |
| Molecular Weight | 219.64 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-(3-aminopropyl)-2-chloro-6-fluorobenzene-1,3-diol |
| SMILES | NCCCc1cc(F)c(O)c(Cl)c1O |
| InChI | InChI=1S/C9H11ClFNO2/c10-7-8(13)5(2-1-3-12)4-6(11)9(7)14/h4,13-14H,1-3,12H2 |
| InChIKey | GOMWKWOTYNEILM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |