C9H12FNO2 — CID 117280042
3-(3-aminopropyl)-6-fluorobenzene-1,2-diol (PubChem CID 117280042) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 3-(3-aminopropyl)-6-fluorobenzene-1,2-diol.
| Compound Name | 3-(3-aminopropyl)-6-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 117280042 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 3-(3-aminopropyl)-6-fluorobenzene-1,2-diol |
| SMILES | NCCCc1ccc(F)c(O)c1O |
| InChI | InChI=1S/C9H12FNO2/c10-7-4-3-6(2-1-5-11)8(12)9(7)13/h3-4,12-13H,1-2,5,11H2 |
| InChIKey | KCIXUWHFUSVPKQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|