C15H24ClNO4 — CID 65303519
N-[2-[2-(2-chloro-4,5-dimethoxyphenyl)ethoxy]ethyl]-2-methoxyethanamine (PubChem CID 65303519) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is N-[2-[2-(2-chloro-4,5-dimethoxyphenyl)ethoxy]ethyl]-2-methoxyethanamine.
| Compound Name | N-[2-[2-(2-chloro-4,5-dimethoxyphenyl)ethoxy]ethyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65303519 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-[2-(2-chloro-4,5-dimethoxyphenyl)ethoxy]ethyl]-2-methoxyethanamine |
| SMILES | COCCNCCOCCc1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C15H24ClNO4/c1-18-8-5-17-6-9-21-7-4-12-10-14(19-2)15(20-3)11-13(12)16/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | RRPZTNCCMHRIJA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|