C13H20ClNO2 — CID 65303014
2-[2-(3-chloro-4-methoxyphenyl)ethoxy]-N-ethylethanamine (PubChem CID 65303014) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-methoxyphenyl)ethoxy]-N-ethylethanamine.
| Compound Name | 2-[2-(3-chloro-4-methoxyphenyl)ethoxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 65303014 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[2-(3-chloro-4-methoxyphenyl)ethoxy]-N-ethylethanamine |
| SMILES | CCNCCOCCc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO2/c1-3-15-7-9-17-8-6-11-4-5-13(16-2)12(14)10-11/h4-5,10,15H,3,6-9H2,1-2H3 |
| InChIKey | UOJBOSYFIQSOEJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|