C24H30O3 — CID 90973642
2-[2-[2-[2,4-dimethyl-6-[2-(oxiran-2-yl)ethyl]phenoxy]-3,5-dimethylphenyl]ethyl]oxirane (PubChem CID 90973642) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[2-[2-[2,4-dimethyl-6-[2-(oxiran-2-yl)ethyl]phenoxy]-3,5-dimethylphenyl]ethyl]oxirane.
| Compound Name | 2-[2-[2-[2,4-dimethyl-6-[2-(oxiran-2-yl)ethyl]phenoxy]-3,5-dimethylphenyl]ethyl]oxirane |
|---|---|
| PubChem CID | 90973642 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[2-[2-[2,4-dimethyl-6-[2-(oxiran-2-yl)ethyl]phenoxy]-3,5-dimethylphenyl]ethyl]oxirane |
| SMILES | Cc1cc(C)c(Oc2c(C)cc(C)cc2CCC2CO2)c(CCC2CO2)c1 |
| InChI | InChI=1S/C24H30O3/c1-15-9-17(3)23(19(11-15)5-7-21-13-25-21)27-24-18(4)10-16(2)12-20(24)6-8-22-14-26-22/h9-12,21-22H,5-8,13-14H2,1-4H3 |
| InChIKey | FBPNGJHRIXPLIS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|