C12H13Cl2F3O2 — CID 83959054
2-(3,5-dichloro-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 83959054) has the molecular formula C12H13Cl2F3O2 and a molecular weight of 317.13 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(3,5-dichloro-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83959054 |
| Molecular Formula | C12H13Cl2F3O2 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-(3,5-dichloro-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C12H13Cl2F3O2/c1-3-4-19-10-8(5-7(13)6-9(10)14)11(2,18)12(15,16)17/h5-6,18H,3-4H2,1-2H3 |
| InChIKey | BTWXJJCQWMXZPG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |