C11H11Cl2F3O2 — CID 83959034
2-(3,5-dichloro-2-ethoxyphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 83959034) has the molecular formula C11H11Cl2F3O2 and a molecular weight of 303.11 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-ethoxyphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(3,5-dichloro-2-ethoxyphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83959034 |
| Molecular Formula | C11H11Cl2F3O2 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(3,5-dichloro-2-ethoxyphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C11H11Cl2F3O2/c1-3-18-9-7(4-6(12)5-8(9)13)10(2,17)11(14,15)16/h4-5,17H,3H2,1-2H3 |
| InChIKey | ADHCVEBYICPKKC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |