C14H20Cl2O3 — CID 83941281
5-(3,5-dichloro-2-ethoxyphenyl)hexane-2,3-diol (PubChem CID 83941281) has the molecular formula C14H20Cl2O3 and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-ethoxyphenyl)hexane-2,3-diol.
| Compound Name | 5-(3,5-dichloro-2-ethoxyphenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83941281 |
| Molecular Formula | C14H20Cl2O3 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(3,5-dichloro-2-ethoxyphenyl)hexane-2,3-diol |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C(C)CC(O)C(C)O |
| InChI | InChI=1S/C14H20Cl2O3/c1-4-19-14-11(6-10(15)7-12(14)16)8(2)5-13(18)9(3)17/h6-9,13,17-18H,4-5H2,1-3H3 |
| InChIKey | FKFRYMJIVCEVDA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |