C14H19F3O2 — CID 83959162
2-(3,5-dimethyl-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 83959162) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(3,5-dimethyl-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83959162 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(3,5-dimethyl-2-propoxyphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCOc1c(C)cc(C)cc1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O2/c1-5-6-19-12-10(3)7-9(2)8-11(12)13(4,18)14(15,16)17/h7-8,18H,5-6H2,1-4H3 |
| InChIKey | YNXIKTCFDQWYDR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |