C15H21F3O2 — CID 83959004
2-(2,5-dimethyl-4-propoxyphenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 83959004) has the molecular formula C15H21F3O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-(2,5-dimethyl-4-propoxyphenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 2-(2,5-dimethyl-4-propoxyphenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 83959004 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(2,5-dimethyl-4-propoxyphenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CCCOc1cc(C)c(C(O)(CC)C(F)(F)F)cc1C |
| InChI | InChI=1S/C15H21F3O2/c1-5-7-20-13-9-10(3)12(8-11(13)4)14(19,6-2)15(16,17)18/h8-9,19H,5-7H2,1-4H3 |
| InChIKey | LHLCPMIFKHNTRM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |