C15H20F4O3 — CID 83949980
1,1,1-trifluoro-2-(2-fluoro-4,5-dipropoxyphenyl)propan-2-ol (PubChem CID 83949980) has the molecular formula C15H20F4O3 and a molecular weight of 324.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-fluoro-4,5-dipropoxyphenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(2-fluoro-4,5-dipropoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 83949980 |
| Molecular Formula | C15H20F4O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-fluoro-4,5-dipropoxyphenyl)propan-2-ol |
| SMILES | CCCOc1cc(F)c(C(C)(O)C(F)(F)F)cc1OCCC |
| InChI | InChI=1S/C15H20F4O3/c1-4-6-21-12-8-10(14(3,20)15(17,18)19)11(16)9-13(12)22-7-5-2/h8-9,20H,4-7H2,1-3H3 |
| InChIKey | XVSPZYOZYSOQHF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |