C14H13F9O2 — CID 58543613
2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58543613) has the molecular formula C14H13F9O2 and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58543613 |
| Molecular Formula | C14H13F9O2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)c(C)cc1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H13F9O2/c1-6-5-9(11(25,13(18,19)20)14(21,22)23)7(2)4-8(6)10(3,24)12(15,16)17/h4-5,24-25H,1-3H3 |
| InChIKey | HOFKKOVYBOOMQM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |