C12H11F9N2O2 — CID 167699667
2-[3,4-diamino-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 167699667) has the molecular formula C12H11F9N2O2 and a molecular weight of 386.21 g/mol. Its IUPAC name is 2-[3,4-diamino-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3,4-diamino-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 167699667 |
| Molecular Formula | C12H11F9N2O2 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[3,4-diamino-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(O)(c1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(N)c1N)C(F)(F)F |
| InChI | InChI=1S/C12H11F9N2O2/c1-8(24,10(13,14)15)5-2-4(3-6(22)7(5)23)9(25,11(16,17)18)12(19,20)21/h2-3,24-25H,22-23H2,1H3 |
| InChIKey | FWJGJWIEPDRSMB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|