C25H32F6N2O2 — CID 90180686
2-[2-amino-5-[[4-amino-3-propyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-propylphenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 90180686) has the molecular formula C25H32F6N2O2 and a molecular weight of 506.53 g/mol. Its IUPAC name is 2-[2-amino-5-[[4-amino-3-propyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-propylphenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[2-amino-5-[[4-amino-3-propyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-propylphenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 90180686 |
| Molecular Formula | C25H32F6N2O2 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[2-amino-5-[[4-amino-3-propyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]methyl]-3-propylphenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCc1cc(Cc2cc(CCC)c(N)c(C(C)(O)C(F)(F)F)c2)cc(C(C)(O)C(F)(F)F)c1N |
| InChI | InChI=1S/C25H32F6N2O2/c1-5-7-16-10-14(12-18(20(16)32)22(3,34)24(26,27)28)9-15-11-17(8-6-2)21(33)19(13-15)23(4,35)25(29,30)31/h10-13,34-35H,5-9,32-33H2,1-4H3 |
| InChIKey | KAFTZAXCLXQWHN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|