C10H9F4IO — CID 138561765
1,1,1-trifluoro-2-(2-fluoro-5-iodo-4-methylphenyl)propan-2-ol (PubChem CID 138561765) has the molecular formula C10H9F4IO and a molecular weight of 348.08 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-fluoro-5-iodo-4-methylphenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(2-fluoro-5-iodo-4-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 138561765 |
| Molecular Formula | C10H9F4IO |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-fluoro-5-iodo-4-methylphenyl)propan-2-ol |
| SMILES | Cc1cc(F)c(C(C)(O)C(F)(F)F)cc1I |
| InChI | InChI=1S/C10H9F4IO/c1-5-3-7(11)6(4-8(5)15)9(2,16)10(12,13)14/h3-4,16H,1-2H3 |
| InChIKey | LXYWDIPWPWTCJM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|