C54H42O4 — CID 15324880
[2-[2-(2,2-dimethylpropanoyloxy)-3,5-bis(2-phenylethynyl)phenyl]-4,6-bis(2-phenylethynyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 15324880) has the molecular formula C54H42O4 and a molecular weight of 754.93 g/mol. Its IUPAC name is [2-[2-(2,2-dimethylpropanoyloxy)-3,5-bis(2-phenylethynyl)phenyl]-4,6-bis(2-phenylethynyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[2-(2,2-dimethylpropanoyloxy)-3,5-bis(2-phenylethynyl)phenyl]-4,6-bis(2-phenylethynyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15324880 |
| Molecular Formula | C54H42O4 |
| Molecular Weight | 754.93 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | [2-[2-(2,2-dimethylpropanoyloxy)-3,5-bis(2-phenylethynyl)phenyl]-4,6-bis(2-phenylethynyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1c(C#Cc2ccccc2)cc(C#Cc2ccccc2)cc1-c1cc(C#Cc2ccccc2)cc(C#Cc2ccccc2)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C54H42O4/c1-53(2,3)51(55)57-49-45(33-31-41-23-15-9-16-24-41)35-43(29-27-39-19-11-7-12-20-39)37-47(49)48-38-44(30-28-40-21-13-8-14-22-40)36-46(34-32-42-25-17-10-18-26-42)50(48)58-52(56)54(4,5)6/h7-26,35-38H,1-6H3 |
| InChIKey | PTTALUJQIZSBHB-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.93 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|