About 5-naphthalen-1-ylquinolin-8-ol;zinc
5-naphthalen-1-ylquinolin-8-ol;zinc (PubChem CID 20606771) has the molecular formula C19H13NOZn
and a molecular weight of 336.71 g/mol. Its IUPAC name is 5-naphthalen-1-ylquinolin-8-ol;zinc.
Molecular Properties
| Compound Name | 5-naphthalen-1-ylquinolin-8-ol;zinc |
| PubChem CID | 20606771 |
| Molecular Formula | C19H13NOZn |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 5-naphthalen-1-ylquinolin-8-ol;zinc |
| SMILES | Oc1ccc(-c2cccc3ccccc23)c2cccnc12.[Zn] |
| InChI | InChI=1S/C19H13NO.Zn/c21-18-11-10-16(17-9-4-12-20-19(17)18)15-8-3-6-13-5-1-2-7-14(13)15;/h1-12,21H; |
| InChIKey | XWMYDKJVWYFZNF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-naphthalen-1-ylquinolin-8-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-naphthalen-1-ylquinolin-8-ol;zinc?
The IUPAC name of 5-naphthalen-1-ylquinolin-8-ol;zinc (CID 20606771) is 5-naphthalen-1-ylquinolin-8-ol;zinc.
What is the SMILES notation for 5-naphthalen-1-ylquinolin-8-ol;zinc?
The canonical SMILES for 5-naphthalen-1-ylquinolin-8-ol;zinc is Oc1ccc(-c2cccc3ccccc23)c2cccnc12.[Zn].
What is the InChIKey of 5-naphthalen-1-ylquinolin-8-ol;zinc?
The InChIKey is XWMYDKJVWYFZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO.Zn/c21-18-11-10-16(17-9-4-12-20-19(17)18)15-8-3-6-13-5-1-2-7-14(13)15;/h1-12,21H;.
What are the key properties of 5-naphthalen-1-ylquinolin-8-ol;zinc?
5-naphthalen-1-ylquinolin-8-ol;zinc has a molecular weight of 336.71 g/mol, XLogP of 4.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-naphthalen-1-ylquinolin-8-ol;zinc is sourced from PubChem (CID 20606771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).